Products 1217500-74-7

CAS 1217500-74-7 appears in our catalog under these names: 3,4-Difluoro-5-(methoxycarbonyl)phenylboronic acid, 98%, 3,4-Difluoro-5-(methoxycarbonyl)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

(3,4-difluoro-5-methoxycarbonylphenyl)boronic acid (CAS 1217500-74-7) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (3,4-difluoro-5-methoxycarbonylphenyl)boronic acid. InChIKey: WIQXVGIUPPVTHA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BF2O4
Molecular weight215.95 g/mol
IUPAC name(3,4-difluoro-5-methoxycarbonylphenyl)boronic acid
InChIKeyWIQXVGIUPPVTHA-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)F)F)C(=O)OC)(O)O

Computed by PubChem (NCBI)