Products 2377608-12-1

CAS 2377608-12-1 appears in our catalog under these names: 2,3-Difluoro-5-(methoxycarbonyl)phenylboronic acid, 97%, (2,3-Difluoro-5-(methoxycarbonyl)phenyl)boronic acid 97%, 2,3-Difluoro-5-(methoxycarbonyl)phenylboronic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-difluoro-5-methoxycarbonylphenyl)boronic acid (CAS 2377608-12-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,3-difluoro-5-methoxycarbonylphenyl)boronic acid. InChIKey: KHRAKJPXWZQQRU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BF2O4
Molecular weight215.95 g/mol
IUPAC name(2,3-difluoro-5-methoxycarbonylphenyl)boronic acid
InChIKeyKHRAKJPXWZQQRU-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)F)C(=O)OC)(O)O

Computed by PubChem (NCBI)