cas: 543683-36-9 — see every product listed under this CAS number, including other names
(2,6-DIfluoro-4-nitrophenyl)acetic acid, 95% (CAS 543683-36-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A726125-5g |
| cas | 543683-36-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14033.95 Pln | |
| AmBeed | 10g | 20804.35 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,6-difluoro-4-nitrophenyl)acetic acid (CAS 543683-36-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,6-difluoro-4-nitrophenyl)acetic acid. InChIKey: MDMRXAYFALTPII-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,6-difluoro-4-nitrophenyl)acetic acid |
| InChIKey | MDMRXAYFALTPII-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)