Products 650-93-1

CAS 650-93-1 appears in our catalog under these names: alpha,alpha-Difluoro-3-nitrobenzeneacetic Acid, 2,2–difluoro–2–(3–nitrophenyl)acetic acid, 2,2-difluoro-2-(3-nitrophenyl)acetic acid. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 500mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(3-nitrophenyl)acetic acid (CAS 650-93-1) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,2-difluoro-2-(3-nitrophenyl)acetic acid. InChIKey: JEMOGCSVCAQBMO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F2NO4
Molecular weight217.13 g/mol
IUPAC name2,2-difluoro-2-(3-nitrophenyl)acetic acid
InChIKeyJEMOGCSVCAQBMO-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C(C(=O)O)(F)F

Computed by PubChem (NCBI)