CAS 650-93-1 appears in our catalog under these names: alpha,alpha-Difluoro-3-nitrobenzeneacetic Acid, 2,2–difluoro–2–(3–nitrophenyl)acetic acid, 2,2-difluoro-2-(3-nitrophenyl)acetic acid. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 500mg, 1g, 250mg.
2,2-difluoro-2-(3-nitrophenyl)acetic acid (CAS 650-93-1) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,2-difluoro-2-(3-nitrophenyl)acetic acid. InChIKey: JEMOGCSVCAQBMO-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-nitrophenyl)acetic acid |
| InChIKey | JEMOGCSVCAQBMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(C(=O)O)(F)F |
Computed by PubChem (NCBI)