(2,6-Dichloropyridin-4-yl)boronic acid 97%
cas: 1072951-54-2 — see every product listed under this CAS number, including other names
(2,6-Dichloropyridin-4-yl)boronic acid 97% (CAS 1072951-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358454-250mg |
| cas | 1072951-54-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 476.06 Pln | |
| Ambeed | 25g | 1065.69 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A358454 |
(2,6-dichloro-4-pyridinyl)boronic acid (CAS 1072951-54-2) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)boronic acid. InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)boronic acid |
| InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-Dichloropyridin-4-yl)boronic acid, 2,6-Dichloropyridine-4-boronicacid, 2,6-dichloropyridin-4-ylboronic acid, Boronic acid, B-(2,6-dichloro-4-pyridinyl)-, (2,6-dichloro-4-pyridyl)boronic acid, JFUQZFQJ, JFUQZFQJFYZZGY-UHFFFAOYSA-N, (2,6-Dichloropyridin-4-yl)boronicacid, (26-Dichloropyridin-4-yl)boronic acid, 2,6-dichloropyridin-4-yl-4-boronic acid