cas: 1072951-54-2 — see every product listed under this CAS number, including other names
(2,6-Dichloropyridin-4-yl)boronic acid, 95% (CAS 1072951-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219122-1G |
| cas | 1072951-54-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 1018.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,6-dichloro-4-pyridinyl)boronic acid (CAS 1072951-54-2) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)boronic acid. InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)boronic acid |
| InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)