Products 536693-97-7

CAS 536693-97-7 appears in our catalog under these names: 2,5-Dichloropyridine-3-boronic acid, 97%, 97%, 2,5-Dichloropyridine-3-boronic acid 97%, 2,5-Dichloropyridine-3-boronic acid, 98%. Offered by: Chemat, Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(2,5-dichloro-3-pyridinyl)boronic acid (CAS 536693-97-7) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,5-dichloro-3-pyridinyl)boronic acid. InChIKey: IISUHTJFLBUMKT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BCl2NO2
Molecular weight191.81 g/mol
IUPAC name(2,5-dichloro-3-pyridinyl)boronic acid
InChIKeyIISUHTJFLBUMKT-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1Cl)Cl)(O)O

Computed by PubChem (NCBI)