Products 1469931-06-3

CAS 1469931-06-3 is the registry number for 3,5-Dichloropyridine-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(3,5-dichloro-4-pyridinyl)boronic acid (CAS 1469931-06-3) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (3,5-dichloro-4-pyridinyl)boronic acid. InChIKey: HJIMAYKWPBCOCV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BCl2NO2
Molecular weight191.81 g/mol
IUPAC name(3,5-dichloro-4-pyridinyl)boronic acid
InChIKeyHJIMAYKWPBCOCV-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1Cl)Cl)(O)O

Computed by PubChem (NCBI)