cas: 1072951-54-2 — see every product listed under this CAS number, including other names
(2,6–Dichloropyridin–4–yl)boronic acid (CAS 1072951-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD10897-100g |
| cas | 1072951-54-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 7645.87 Pln | |
| GLPBio | 1g | 540.87 Pln | |
| GLPBio | 25g | 2347.55 Pln | |
| GLPBio | 5g | 877.87 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-dichloro-4-pyridinyl)boronic acid (CAS 1072951-54-2) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)boronic acid. InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)boronic acid |
| InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)