CAS 1072951-54-2 appears in our catalog under these names: 2,6-Dichloropyridine-4-boronic acid, 98%, (2,6–Dichloropyridin–4–yl)boronic acid, (2,6-Dichloropyridin-4-yl)boronic acid, 95%, 95%, (2,6-Dichloropyridin-4-yl)boronic acid, 99.97%, (2,6-Dichloropyridin-4-yl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg, 5 g, 1 g.
(2,6-dichloro-4-pyridinyl)boronic acid (CAS 1072951-54-2) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)boronic acid. InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)boronic acid |
| InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)