cas: 1072951-54-2 — see every product listed under this CAS number, including other names
(2,6-Dichloropyridin-4-yl)boronic acid, 99.97% (CAS 1072951-54-2) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W005531-5 g |
| cas | 1072951-54-2 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 454.37 Pln | |
| MedChemExpress | 1 g | 254.68 Pln | |
| MedChemExpress | 10 g | 649.42 Pln | |
| MedChemExpress | 25 g | 1174.19 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
(2,6-dichloro-4-pyridinyl)boronic acid (CAS 1072951-54-2) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-4-pyridinyl)boronic acid. InChIKey: JFUQZFQJFYZZGY-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-4-pyridinyl)boronic acid |
| InChIKey | JFUQZFQJFYZZGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)