cas: 957065-86-0 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-hydroxyphenyl)boronic acid, 97%, 97% (CAS 957065-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJDQ-250mg |
| cas | 957065-86-0 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1446.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,6-difluoro-3-hydroxyphenyl)boronic acid (CAS 957065-86-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: YTKYZCCDBZCCOK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | YTKYZCCDBZCCOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)F)(O)O |
Computed by PubChem (NCBI)