CAS 957065-86-0 appears in our catalog under these names: 2,6-Difluoro-3-hydroxyphenylboronic acid, 98%, 2,6–Difluoro–3–hydroxyphenylboronic acid, (2,6-Difluoro-3-hydroxyphenyl)boronic acid, 97%, 97%, (2,6-Difluoro-3-hydroxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2,6-difluoro-3-hydroxyphenyl)boronic acid (CAS 957065-86-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: YTKYZCCDBZCCOK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | YTKYZCCDBZCCOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)F)(O)O |
Computed by PubChem (NCBI)