cas: 957065-86-0 — see every product listed under this CAS number, including other names
2,6–Difluoro–3–hydroxyphenylboronic acid (CAS 957065-86-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD10869-10g |
| cas | 957065-86-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1561.22 Pln | |
| GLPBio | 1g | 653.21 Pln | |
| GLPBio | 250mg | 526.83 Pln | |
| GLPBio | 5g | 1135.30 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-difluoro-3-hydroxyphenyl)boronic acid (CAS 957065-86-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: YTKYZCCDBZCCOK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | YTKYZCCDBZCCOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)F)(O)O |
Computed by PubChem (NCBI)