Products 1229584-22-8
CAS 1229584-22-8 appears in our catalog under these names: 2,5-Difluoro-4-hydroxyphenylboronic acid, 95%, (2,5-Difluoro-4-hydroxyphenyl)boronic acid, 97%, (2,5-Difluoro-4-hydroxyphenyl)boronic acid, 2,5-Difluoro-4-hydroxyphenylboronic acid, 95%, 95%, (2,5-Difluoro-4-hydroxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(2,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1229584-22-8) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: BKSUWYUPEDFFDX-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,5-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | BKSUWYUPEDFFDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)O)F)(O)O |
Computed by PubChem (NCBI)