Products 1132666-81-9

CAS 1132666-81-9 appears in our catalog under these names: 3,5-Difluoro-4-hydroxyphenylboronic acid, 98%, (3,5–Difluoro–4–hydroxyphenyl)boronic acid, (3,5-Difluoro-4-hydroxyphenyl)boronic acid 98+%, (3,5-Difluoro-4-hydroxyphenyl)boronic acid 98%, (3,5-Difluoro-4-hydroxyphenyl)boronic acid, 98+%, 98+%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 10g.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1132666-81-9) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: ZLSDOFHBADFRMF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BF2O3
Molecular weight173.91 g/mol
IUPAC name(3,5-difluoro-4-hydroxyphenyl)boronic acid
InChIKeyZLSDOFHBADFRMF-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)F)O)F)(O)O

Computed by PubChem (NCBI)