CAS 1150114-51-4 appears in our catalog under these names: 3,5-Difluoro-2-hydroxyphenylboronic acid, 98%, (3,5–Difluoro–2–hydroxyphenyl)boronic acid, (3,5-Difluoro-2-Hydroxyphenyl)Boronic Acid, 98%, 98%, (3,5-Difluoro-2-hydroxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g.
(3,5-difluoro-2-hydroxyphenyl)boronic acid (CAS 1150114-51-4) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (3,5-difluoro-2-hydroxyphenyl)boronic acid. InChIKey: DMZXNOGEVAESIC-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (3,5-difluoro-2-hydroxyphenyl)boronic acid |
| InChIKey | DMZXNOGEVAESIC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1O)F)F)(O)O |
Computed by PubChem (NCBI)