cas: 957065-86-0 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-hydroxyphenyl)boronic acid, 98% (CAS 957065-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225773-1G |
| cas | 957065-86-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 799.74 Pln | |
| Fluorochem | 25g | 1841.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,6-difluoro-3-hydroxyphenyl)boronic acid (CAS 957065-86-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: YTKYZCCDBZCCOK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | YTKYZCCDBZCCOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)F)(O)O |
Computed by PubChem (NCBI)