cas: 849062-04-0 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-isopropoxyphenyl)boronic acid, 98% (CAS 849062-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696424-250MG |
| cas | 849062-04-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 357.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 849062-04-0) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: YMUAZQJBMFLGEI-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | YMUAZQJBMFLGEI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)