Products 2096329-68-7
CAS 2096329-68-7 appears in our catalog under these names: 2,4-Difluoro-3-propoxyphenylboronic acid, 98%, (2,4-Difluoro-3-propoxyphenyl)boronic acid 97%, 2,4-DIFLUORO-3-PROPOXYPHENYLBORONIC ACID, 97%, 97%, 2,4-Difluoro-3-propoxyphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 250mg.
(2,4-difluoro-3-propoxyphenyl)boronic acid (CAS 2096329-68-7) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,4-difluoro-3-propoxyphenyl)boronic acid. InChIKey: BUFQSDWLWIWVKM-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,4-difluoro-3-propoxyphenyl)boronic acid |
| InChIKey | BUFQSDWLWIWVKM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OCCC)F)(O)O |
Computed by PubChem (NCBI)