CAS 1072951-61-1 appears in our catalog under these names: 4,5-Difluoro-2-isopropoxyphenylboronic acid, 96%, (4,5-Difluoro-2-isopropoxyphenyl)boronic acid, 96%, (4,5-Difluoro-2-isopropoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(4,5-difluoro-2-propan-2-yloxyphenyl)boronic acid (CAS 1072951-61-1) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (4,5-difluoro-2-propan-2-yloxyphenyl)boronic acid. InChIKey: RTEYYHDTNPHABZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (4,5-difluoro-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | RTEYYHDTNPHABZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC(C)C)F)F)(O)O |
Computed by PubChem (NCBI)