Products 849062-04-0

CAS 849062-04-0 appears in our catalog under these names: 2,6-Difluoro-3-isopropoxyphenylboronic acid, 98%, (2,6-Difluoro-3-isopropoxyphenyl)boronic acid 98%, (2,6-Difluoro-3-isopropoxyphenyl)boronic acid, 98%, 98%, (2,6-Difluoro-3-isopropoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

(2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 849062-04-0) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: YMUAZQJBMFLGEI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BF2O3
Molecular weight215.99 g/mol
IUPAC name(2,6-difluoro-3-propan-2-yloxyphenyl)boronic acid
InChIKeyYMUAZQJBMFLGEI-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)OC(C)C)F)(O)O

Computed by PubChem (NCBI)