Products 2096336-30-8
CAS 2096336-30-8 is the registry number for 3-Ethoxy-2,4-difluoro-5-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(3-ethoxy-2,4-difluoro-5-methylphenyl)boronic acid (CAS 2096336-30-8) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (3-ethoxy-2,4-difluoro-5-methylphenyl)boronic acid. InChIKey: CGCHCBGEJXKDLL-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (3-ethoxy-2,4-difluoro-5-methylphenyl)boronic acid |
| InChIKey | CGCHCBGEJXKDLL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OCC)F)C)(O)O |
Computed by PubChem (NCBI)