CAS 1451390-93-4 appears in our catalog under these names: 3,5-Difluoro-4-isopropoxyphenylboronic acid, 98%, (3,5-Difluoro-4-isopropoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 25g.
(3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 1451390-93-4) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: SHSBRMCUHPYPIR-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | SHSBRMCUHPYPIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)