Products 1451390-95-6

CAS 1451390-95-6 appears in our catalog under these names: (2,4-Difluoro-3-isopropoxyphenyl)boronic acid, ≥95%, 2,4-Difluoro-3-isopropoxyphenylboronic acid, 98%, 2,4-Difluoro-3-isopropoxyphenylboronic acid 98%, 2,4-Difluoro-3-isopropoxyphenylboronic acid, 98% ,, 98% ,. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1451390-95-6) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: LTXLJWCQTYVYCS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BF2O3
Molecular weight215.99 g/mol
IUPAC name(2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid
InChIKeyLTXLJWCQTYVYCS-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)F)OC(C)C)F)(O)O

Computed by PubChem (NCBI)