CAS 1451390-95-6 appears in our catalog under these names: 2,4-Difluoro-3-isopropoxyphenylboronic acid, 98%, 2,4-Difluoro-3-isopropoxyphenylboronic acid 98%, 2,4-Difluoro-3-isopropoxyphenylboronic acid, 98% ,, 98% ,, (2,4-Difluoro-3-isopropoxyphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1451390-95-6) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: LTXLJWCQTYVYCS-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | LTXLJWCQTYVYCS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)