cas: 849062-14-2 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-propoxyphenyl)boronic acid (CAS 849062-14-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691749-5G |
| cas | 849062-14-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1153.78 Pln | |
| Fluorochem | 10g | 1903.51 Pln |
| delivery time | 3-4 weeks |
|---|
(2,6-difluoro-3-propoxyphenyl)boronic acid (CAS 849062-14-2) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-3-propoxyphenyl)boronic acid. InChIKey: AGDROYNYQZNERV-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,6-difluoro-3-propoxyphenyl)boronic acid |
| InChIKey | AGDROYNYQZNERV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCCC)F)(O)O |
Computed by PubChem (NCBI)