(2,6-Difluoro-4-isopropoxyphenyl)boronic acid, 97%
cas: 2096337-66-3 — see every product listed under this CAS number, including other names
(2,6-Difluoro-4-isopropoxyphenyl)boronic acid, 97% (CAS 2096337-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A233815-100mg |
| cas | 2096337-66-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 737.50 Pln | |
| Ambeed | 25g | 2356.19 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 786.41 Pln | |
| BLDpharm | 25g | 2535.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 2096337-66-3) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: DHCDNEJEXMOLHK-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | DHCDNEJEXMOLHK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-Difluoro-4-isopropoxyphenyl)boronic acid, 2,6-Difluoro-4-isopropoxyphenylboronic acid, 2,6-Difluoro-4-isopropyloxyphenylboronic acid, (2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid, [2,6-difluoro-4-(propan-2-yloxy)phenyl]boronic acid, {2,6-Difluoro-4-[(propan-2-yl)oxy]phenyl}boronic acid, Boronic acid, B-[2,6-difluoro-4-(1-methylethoxy)phenyl]-