CAS 2096337-66-3 appears in our catalog under these names: (2,6-Difluoro-4-isopropoxyphenyl)boronic acid 97%, 2,6-DIFLUORO-4-ISOPROPOXYPHENYLBORONIC ACID, 97%, 97%, 2,6-DIFLUORO-4-ISOPROPOXYPHENYLBORONIC ACID, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 2096337-66-3) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: DHCDNEJEXMOLHK-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (2,6-difluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | DHCDNEJEXMOLHK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)