cas: 1311163-93-5 — see every product listed under this CAS number, including other names
(2-((3-Methylbenzyl)oxy)phenyl)boronic acid 98% (CAS 1311163-93-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1338702-50mg |
| cas | 1311163-93-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 225.75 Pln | |
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1260.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1338702 |
[2-[(3-methylphenyl)methoxy]phenyl]boronic acid (CAS 1311163-93-5) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: [2-[(3-methylphenyl)methoxy]phenyl]boronic acid. InChIKey: QYZHCROTEXJECX-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [2-[(3-methylphenyl)methoxy]phenyl]boronic acid |
| InChIKey | QYZHCROTEXJECX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=CC=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)