CAS 338454-30-1 appears in our catalog under these names: 4-Benzyloxy-3-methylphenylboronic acid, 97%, (4-(Benzyloxy)-3-methylphenyl)boronic acid, 95-<97%, (4-(Benzyloxy)-3-methylphenyl)boronic acid, ≥97-<99%, 4–Benzyloxy–3–methylbenzeneboronic acid(contains varying amounts of Anhydride), 4-Benzyloxy-3-methylbenzeneboronic acid, 96% . Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 50g, 200g, 300g.
(3-methyl-4-phenylmethoxyphenyl)boronic acid (CAS 338454-30-1) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (3-methyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: QPXFEWQLALNXEZ-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (3-methyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | QPXFEWQLALNXEZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)