CAS 1256355-61-9 appears in our catalog under these names: 3-(Benzyloxy)-5-methylphenylboronic acid, 98%, (3-(Benzyloxy)-5-methylphenyl)boronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 1g.
(3-methyl-5-phenylmethoxyphenyl)boronic acid (CAS 1256355-61-9) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (3-methyl-5-phenylmethoxyphenyl)boronic acid. InChIKey: BDGZZCFVEWEVJB-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (3-methyl-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | BDGZZCFVEWEVJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)