CAS 1451391-56-2 is the registry number for 5-(Benzyloxy)-2-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2-methyl-5-phenylmethoxyphenyl)boronic acid (CAS 1451391-56-2) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (2-methyl-5-phenylmethoxyphenyl)boronic acid. InChIKey: PHZUZAMBWZEFSP-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (2-methyl-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | PHZUZAMBWZEFSP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)