Products 182344-29-2
CAS 182344-29-2 is the registry number for 4-Ethoxybiphenyl-4'-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
[4-(4-ethoxyphenyl)phenyl]boronic acid (CAS 182344-29-2) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: [4-(4-ethoxyphenyl)phenyl]boronic acid. InChIKey: ZFFXATWYKJBSCC-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [4-(4-ethoxyphenyl)phenyl]boronic acid |
| InChIKey | ZFFXATWYKJBSCC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Ethoxybiphenyl-4'-boronic acid, (4'-Ethoxy-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-ethoxyphenyl)phenyl]boronic acid, Boronic acid, B-(4'-ethoxy[1,1'-biphenyl]-4-yl)-, (4'-Ethoxy-[1,1'-biphenyl]-4-yl)boronicacid, 4-Ethoxybiphenyl-4'-boronicacid, 4-Ethoxybiphenyl-4''-boronic Acid, (4'-Ethoxy[1,1'-biphenyl]-4-yl)boronic acid