CAS 1311182-76-9 appears in our catalog under these names: [4-(4'-methylbenzyloxy)phenyl]boronic acid, 95%, (4-((4-Methylbenzyl)oxy)phenyl)boronic acid, 98%, 4–(4–Methylphenoxy) phenylboronic acid, Boronic acid, B-[4-[(4-methylphenyl)methoxy]phenyl]-, 95%, 95%, 4-(4-METHYLBENZYLOXY)BENZENEBORONIC ACID, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[4-[(4-methylphenyl)methoxy]phenyl]boronic acid (CAS 1311182-76-9) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: [4-[(4-methylphenyl)methoxy]phenyl]boronic acid. InChIKey: VDNJTMREUYRXMT-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [4-[(4-methylphenyl)methoxy]phenyl]boronic acid |
| InChIKey | VDNJTMREUYRXMT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)