Products 177190-68-0
CAS 177190-68-0 appears in our catalog under these names: 2-(Benzyloxy)-3-methylphenylboronic acid, 98%, 2-(Benzyloxy)-3-methylphenylboronic acid 98%, 2-(Benzyloxy)-3-methylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
(3-methyl-2-phenylmethoxyphenyl)boronic acid (CAS 177190-68-0) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (3-methyl-2-phenylmethoxyphenyl)boronic acid. InChIKey: UULANZGAYLJKDW-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (3-methyl-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | UULANZGAYLJKDW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)