CAS 133115-55-6 appears in our catalog under these names: (3-(Trifluoromethoxy)phenyl)hydrazine hydrochloride, 97%, 97%, (3-(Trifluoromethoxy)phenyl)hydrazinehydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
[3-(trifluoromethoxy)phenyl]hydrazine;hydrochloride (CAS 133115-55-6) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [3-(trifluoromethoxy)phenyl]hydrazine;hydrochloride. InChIKey: ZXDHJICZICMRLF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [3-(trifluoromethoxy)phenyl]hydrazine;hydrochloride |
| InChIKey | ZXDHJICZICMRLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)