CAS 2682112-84-9 is the registry number for 3-(2,2,2-TRIFLUOROETHOXY)PYRIDIN-4-AMINE HYDROCHLORIDE, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
3-(2,2,2-trifluoroethoxy)pyridin-4-amine;hydrochloride (CAS 2682112-84-9) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)pyridin-4-amine;hydrochloride. InChIKey: TUDGKAJAZWIFNP-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)pyridin-4-amine;hydrochloride |
| InChIKey | TUDGKAJAZWIFNP-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1N)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)