CAS 2044706-60-5 is the registry number for (5-(Trifluoromethoxy)pyridin-2-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[5-(trifluoromethoxy)-2-pyridinyl]methanamine;hydrochloride (CAS 2044706-60-5) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: [5-(trifluoromethoxy)-2-pyridinyl]methanamine;hydrochloride. InChIKey: FYYLDSOMTOVBMI-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | [5-(trifluoromethoxy)-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | FYYLDSOMTOVBMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)