CAS 2248299-68-3 is the registry number for 5-(2,2,2-Trifluoroethoxy)pyridin-2-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(2,2,2-trifluoroethoxy)pyridin-2-amine;hydrochloride (CAS 2248299-68-3) is a chemical compound with the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. IUPAC name: 5-(2,2,2-trifluoroethoxy)pyridin-2-amine;hydrochloride. InChIKey: NXQLBODKTAGIHE-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2O |
|---|---|
| Molecular weight | 228.60 g/mol |
| IUPAC name | 5-(2,2,2-trifluoroethoxy)pyridin-2-amine;hydrochloride |
| InChIKey | NXQLBODKTAGIHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)