cas: 849062-34-6 — see every product listed under this CAS number, including other names
(2-Bromo-4,5-difluorophenyl)boronic acid 95% (CAS 849062-34-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A478450-250mg |
| cas | 849062-34-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A478450 |
(2-bromo-4,5-difluorophenyl)boronic acid (CAS 849062-34-6) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (2-bromo-4,5-difluorophenyl)boronic acid. InChIKey: LUHSZNLWFYNKCZ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (2-bromo-4,5-difluorophenyl)boronic acid |
| InChIKey | LUHSZNLWFYNKCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)F)F)(O)O |
Computed by PubChem (NCBI)