CAS 1315339-48-0 appears in our catalog under these names: 2,4-Difluoro-6-bromophenylboronic acid, 95%, 2,4-Difluoro-6-bromophenylboronic acid, 98%, 98%, (2-Bromo-4,6-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g.
(2-bromo-4,6-difluorophenyl)boronic acid (CAS 1315339-48-0) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (2-bromo-4,6-difluorophenyl)boronic acid. InChIKey: POXLFROUJDNFPQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (2-bromo-4,6-difluorophenyl)boronic acid |
| InChIKey | POXLFROUJDNFPQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Br)F)F)(O)O |
Computed by PubChem (NCBI)