CAS 870718-10-8 appears in our catalog under these names: 6-Bromo-2,3-difluorophenylboronic acid, 96%, (6-Bromo-2,3-difluorophenyl)boronic acid, 98%, 2-Bromo-5,6-difluorophenylboronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g, 100g.
(6-bromo-2,3-difluorophenyl)boronic acid (CAS 870718-10-8) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (6-bromo-2,3-difluorophenyl)boronic acid. InChIKey: VZVDYVBOSRNBQL-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (6-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | VZVDYVBOSRNBQL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)