CAS 2377609-38-4 appears in our catalog under these names: (3-Bromo-2,4-difluorophenyl)boronic acid, 97%, (3-Bromo-2,4-difluorophenyl)boronic acid, 98%, (3-Bromo-2,4-Difluorophenyl)Boronic Acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 500mg.
(3-bromo-2,4-difluorophenyl)boronic acid (CAS 2377609-38-4) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (3-bromo-2,4-difluorophenyl)boronic acid. InChIKey: GXYAIRRGHDIHNV-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (3-bromo-2,4-difluorophenyl)boronic acid |
| InChIKey | GXYAIRRGHDIHNV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)Br)F)(O)O |
Computed by PubChem (NCBI)