CAS 849062-34-6 appears in our catalog under these names: 2-Bromo-4,5-difluorophenylboronic acid, 95%, (2-Bromo-4,5-difluorophenyl)boronic acid 95%, 2-Bromo-4,5-difluorophenylboronic acid, 95%, 95%, (2-Bromo-4,5-difluorophenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
(2-bromo-4,5-difluorophenyl)boronic acid (CAS 849062-34-6) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (2-bromo-4,5-difluorophenyl)boronic acid. InChIKey: LUHSZNLWFYNKCZ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (2-bromo-4,5-difluorophenyl)boronic acid |
| InChIKey | LUHSZNLWFYNKCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)F)F)(O)O |
Computed by PubChem (NCBI)