Products 1106676-82-7
CAS 1106676-82-7 appears in our catalog under these names: 4-Bromo-2,5-difluorobenzeneboronic acid, 98%, 4–Bromo–2，5–difluorophenylboronic acid, (4-Bromo-2,5-difluorophenyl)boronic acid 98%, 4-Bromo-2,5-bifluorophenylboronic acid, 98%, 98%, (4-Bromo-2,5-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
(4-bromo-2,5-difluorophenyl)boronic acid (CAS 1106676-82-7) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)boronic acid. InChIKey: RWBIJRFCSHAOGQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)boronic acid |
| InChIKey | RWBIJRFCSHAOGQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)F)(O)O |
Computed by PubChem (NCBI)