CAS 2096339-65-8 appears in our catalog under these names: 5-Bromo-2,3-difluorophenylboronic acid, 96%, 5-Bromo-2,3-difluorophenylboronic acid, 97%, 97%, 5-Bromo-2,3-difluorophenylboronic acid, 97%, (5-Bromo-2,3-difluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
(5-bromo-2,3-difluorophenyl)boronic acid (CAS 2096339-65-8) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (5-bromo-2,3-difluorophenyl)boronic acid. InChIKey: WMJVJEUQKZBXHN-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (5-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | WMJVJEUQKZBXHN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)Br)(O)O |
Computed by PubChem (NCBI)