cas: 1190875-60-5 — see every product listed under this CAS number, including other names
(2-CHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)METHANOL, 97% (CAS 1190875-60-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F816733-250MG |
| cas | 1190875-60-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 2408.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-chloro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1190875-60-5) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [3-chloro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: GPDIABAAAASRGZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [3-chloro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | GPDIABAAAASRGZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)Cl)(O)O |
Computed by PubChem (NCBI)