Products 385370-80-9

CAS 385370-80-9 appears in our catalog under these names: 2–Chloro–6–methoxyphenylboronic acid(contains varying amounts of Anhydride), 2-Chloro-6-methoxyphenylboronic Acid (contains varying amounts of Anhydride), 2-Chloro-6-methoxyphenylboronic acid 97%, 2-Chloro-6-methoxyphenylboronic acid, 97%, 97%, 2-Chloro-6-methoxyphenylboronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g, 100g, 500g.

Structural formula: {0} (CAS {1})

(2-chloro-6-methoxyphenyl)boronic acid (CAS 385370-80-9) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: (2-chloro-6-methoxyphenyl)boronic acid. InChIKey: XNWCIDBPLDKKAG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BClO3
Molecular weight186.40 g/mol
IUPAC name(2-chloro-6-methoxyphenyl)boronic acid
InChIKeyXNWCIDBPLDKKAG-UHFFFAOYSA-N
SMILESB(C1=C(C=CC=C1Cl)OC)(O)O

Computed by PubChem (NCBI)