Products 89694-47-3
CAS 89694-47-3 appears in our catalog under these names: 4-Choro-3-methoxyphenylboronic acid, 98%, (4-Chloro-3-methoxyphenyl)boronic acid 98%, 4–Chloro–3–methoxyphenylboronic acid (contains varying amounts of Anhydride), 4-Chloro-3-methoxyphenylboronic Acid (contains varying amounts of Anhydride), B-(4-Chloro-3-methoxyphenyl)boronic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg.
(4-chloro-3-methoxyphenyl)boronic acid (CAS 89694-47-3) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: (4-chloro-3-methoxyphenyl)boronic acid. InChIKey: DZNNRXURZJLARZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | (4-chloro-3-methoxyphenyl)boronic acid |
| InChIKey | DZNNRXURZJLARZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-chloro-3-methoxyphenyl)boronic acid, 4-chloro-3-methoxyphenylboronic acid, 4-chloro-3-methoxybenzeneboronic acid, B-(4-Chloro-3-methoxyphenyl)boronic acid, 4-Choro-3-methoxyphenylboronic acid, 4-chloro-3-methoxyphenyl boronic acid, 4-Chloro-3-methoxyphenylboronic Acid (contains varying amounts of Anhydride), Boronic acid, (4-chloro-3-methoxyphenyl)-, 4-chloro-3-methox, 4-chloro-5-methoxyphenylboronic acid