Products 1430237-54-9
CAS 1430237-54-9 appears in our catalog under these names: 4-Chloro-3-(hydroxymethyl)phenylboronic acid, 98%, 4-Chloro-3-(hydroxymethyl)phenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
[4-chloro-3-(hydroxymethyl)phenyl]boronic acid (CAS 1430237-54-9) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [4-chloro-3-(hydroxymethyl)phenyl]boronic acid. InChIKey: QYYROAZVVUGRER-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [4-chloro-3-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | QYYROAZVVUGRER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CO)(O)O |
Computed by PubChem (NCBI)